C19H22F2IN3O — CID 111949538
1-[2-(3,5-difluorophenyl)ethyl]-3-(2,3-dihydro-1-benzofuran-2-ylmethyl)-2-methylguanidine;hydroiodide (PubChem CID 111949538) has the molecular formula C19H22F2IN3O and a molecular weight of 473.31 g/mol. Its IUPAC name is 1-[2-(3,5-difluorophenyl)ethyl]-3-(2,3-dihydro-1-benzofuran-2-ylmethyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(3,5-difluorophenyl)ethyl]-3-(2,3-dihydro-1-benzofuran-2-ylmethyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111949538 |
| Molecular Formula | C19H22F2IN3O |
| Molecular Weight | 473.31 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | 1-[2-(3,5-difluorophenyl)ethyl]-3-(2,3-dihydro-1-benzofuran-2-ylmethyl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1cc(F)cc(F)c1)NCC1Cc2ccccc2O1.I |
| InChI | InChI=1S/C19H21F2N3O.HI/c1-22-19(23-7-6-13-8-15(20)11-16(21)9-13)24-12-17-10-14-4-2-3-5-18(14)25-17;/h2-5,8-9,11,17H,6-7,10,12H2,1H3,(H2,22,23,24);1H |
| InChIKey | AVPXABQNZCMZOO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|