C23H23FN4O2 — CID 111949655
1-(2,3-dihydro-1-benzofuran-2-ylmethyl)-3-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]-2-methylguanidine (PubChem CID 111949655) has the molecular formula C23H23FN4O2 and a molecular weight of 406.46 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzofuran-2-ylmethyl)-3-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]-2-methylguanidine.
| Compound Name | 1-(2,3-dihydro-1-benzofuran-2-ylmethyl)-3-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111949655 |
| Molecular Formula | C23H23FN4O2 |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 1-(2,3-dihydro-1-benzofuran-2-ylmethyl)-3-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCc1cccnc1Oc1cccc(F)c1)NCC1Cc2ccccc2O1 |
| InChI | InChI=1S/C23H23FN4O2/c1-25-23(28-15-20-12-16-6-2-3-10-21(16)29-20)27-14-17-7-5-11-26-22(17)30-19-9-4-8-18(24)13-19/h2-11,13,20H,12,14-15H2,1H3,(H2,25,27,28) |
| InChIKey | NLXJMEWYXJRMDC-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|