About 1-azatricyclo[6.4.1.04,13]trideca-4(13),5,7-triene-9,12-dione
1-azatricyclo[6.4.1.04,13]trideca-4(13),5,7-triene-9,12-dione (PubChem CID 11195004) has the molecular formula C12H11NO2
and a molecular weight of 201.22 g/mol. Its IUPAC name is 1-azatricyclo[6.4.1.04,13]trideca-4(13),5,7-triene-9,12-dione.
Analyze 1-azatricyclo[6.4.1.04,13]trideca-4(13),5,7-triene-9,12-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azatricyclo[6.4.1.04,13]trideca-4(13),5,7-triene-9,12-dione?
The IUPAC name of 1-azatricyclo[6.4.1.04,13]trideca-4(13),5,7-triene-9,12-dione (CID 11195004) is 1-azatricyclo[6.4.1.04,13]trideca-4(13),5,7-triene-9,12-dione.
What is the SMILES notation for 1-azatricyclo[6.4.1.04,13]trideca-4(13),5,7-triene-9,12-dione?
The canonical SMILES for 1-azatricyclo[6.4.1.04,13]trideca-4(13),5,7-triene-9,12-dione is O=C1CCC(=O)N2CCc3cccc1c32.
What is the InChIKey of 1-azatricyclo[6.4.1.04,13]trideca-4(13),5,7-triene-9,12-dione?
The InChIKey is HUZRDLIPCFTNIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO2/c14-10-4-5-11(15)13-7-6-8-2-1-3-9(10)12(8)13/h1-3H,4-7H2.
What are the key properties of 1-azatricyclo[6.4.1.04,13]trideca-4(13),5,7-triene-9,12-dione?
1-azatricyclo[6.4.1.04,13]trideca-4(13),5,7-triene-9,12-dione has a molecular weight of 201.22 g/mol, XLogP of 1.55, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azatricyclo[6.4.1.04,13]trideca-4(13),5,7-triene-9,12-dione is sourced from PubChem (CID 11195004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).