C24H31N3O2 — CID 111950131
1-(2,3-dihydro-1-benzofuran-2-ylmethyl)-3-ethyl-2-[(4-phenyloxan-4-yl)methyl]guanidine (PubChem CID 111950131) has the molecular formula C24H31N3O2 and a molecular weight of 393.53 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzofuran-2-ylmethyl)-3-ethyl-2-[(4-phenyloxan-4-yl)methyl]guanidine.
| Compound Name | 1-(2,3-dihydro-1-benzofuran-2-ylmethyl)-3-ethyl-2-[(4-phenyloxan-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111950131 |
| Molecular Formula | C24H31N3O2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | 1-(2,3-dihydro-1-benzofuran-2-ylmethyl)-3-ethyl-2-[(4-phenyloxan-4-yl)methyl]guanidine |
| SMILES | CCN/C(=N\CC1(c2ccccc2)CCOCC1)NCC1Cc2ccccc2O1 |
| InChI | InChI=1S/C24H31N3O2/c1-2-25-23(26-17-21-16-19-8-6-7-11-22(19)29-21)27-18-24(12-14-28-15-13-24)20-9-4-3-5-10-20/h3-11,21H,2,12-18H2,1H3,(H2,25,26,27) |
| InChIKey | AEYWZGPSRGGDPH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|