C23H30N4O3S — CID 111950225
1-(2,3-dihydro-1-benzofuran-2-ylmethyl)-2-methyl-3-[(3-piperidin-1-ylsulfonylphenyl)methyl]guanidine (PubChem CID 111950225) has the molecular formula C23H30N4O3S and a molecular weight of 442.59 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzofuran-2-ylmethyl)-2-methyl-3-[(3-piperidin-1-ylsulfonylphenyl)methyl]guanidine.
| Compound Name | 1-(2,3-dihydro-1-benzofuran-2-ylmethyl)-2-methyl-3-[(3-piperidin-1-ylsulfonylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111950225 |
| Molecular Formula | C23H30N4O3S |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 1-(2,3-dihydro-1-benzofuran-2-ylmethyl)-2-methyl-3-[(3-piperidin-1-ylsulfonylphenyl)methyl]guanidine |
| SMILES | C/N=C(\NCc1cccc(S(=O)(=O)N2CCCCC2)c1)NCC1Cc2ccccc2O1 |
| InChI | InChI=1S/C23H30N4O3S/c1-24-23(26-17-20-15-19-9-3-4-11-22(19)30-20)25-16-18-8-7-10-21(14-18)31(28,29)27-12-5-2-6-13-27/h3-4,7-11,14,20H,2,5-6,12-13,15-17H2,1H3,(H2,24,25,26) |
| InChIKey | SZMQPDRXLPUMLG-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|