C20H33IN6O2S — CID 111950904
1-[[2-(tert-butylsulfamoyl)phenyl]methyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111950904) has the molecular formula C20H33IN6O2S and a molecular weight of 548.50 g/mol. Its IUPAC name is 1-[[2-(tert-butylsulfamoyl)phenyl]methyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[[2-(tert-butylsulfamoyl)phenyl]methyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111950904 |
| Molecular Formula | C20H33IN6O2S |
| Molecular Weight | 548.50 g/mol |
| Exact Mass | 548.14 |
| IUPAC Name | 1-[[2-(tert-butylsulfamoyl)phenyl]methyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccccc1S(=O)(=O)NC(C)(C)C)NCc1c(C)nn(C)c1C.I |
| InChI | InChI=1S/C20H32N6O2S.HI/c1-14-17(15(2)26(7)24-14)13-23-19(21-6)22-12-16-10-8-9-11-18(16)29(27,28)25-20(3,4)5;/h8-11,25H,12-13H2,1-7H3,(H2,21,22,23);1H |
| InChIKey | BNBOFFSOXCXFPR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 100.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.50 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|