C13H18O2 — CID 11195103
(5aR,8aS)-7,7-dimethyl-2,3,5a,6,8,8a-hexahydro-1H-pentaleno[2,1-b]pyran-5-one (PubChem CID 11195103) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is (5aR,8aS)-7,7-dimethyl-2,3,5a,6,8,8a-hexahydro-1H-pentaleno[2,1-b]pyran-5-one.
| Compound Name | (5aR,8aS)-7,7-dimethyl-2,3,5a,6,8,8a-hexahydro-1H-pentaleno[2,1-b]pyran-5-one |
|---|---|
| PubChem CID | 11195103 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | (5aR,8aS)-7,7-dimethyl-2,3,5a,6,8,8a-hexahydro-1H-pentaleno[2,1-b]pyran-5-one |
| SMILES | CC1(C)C[C@@H]2C3=C(OCCC3)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C13H18O2/c1-13(2)6-9-8-4-3-5-15-12(8)11(14)10(9)7-13/h9-10H,3-7H2,1-2H3/t9-,10-/m1/s1 |
| InChIKey | WDVCKZJVZSWNPC-NXEZZACHSA-N |
| XLogP | 2.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |