C17H24BrClIN5 — CID 111951684
2-[(4-bromo-2-chlorophenyl)methyl]-1-ethyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111951684) has the molecular formula C17H24BrClIN5 and a molecular weight of 540.68 g/mol. Its IUPAC name is 2-[(4-bromo-2-chlorophenyl)methyl]-1-ethyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-[(4-bromo-2-chlorophenyl)methyl]-1-ethyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111951684 |
| Molecular Formula | C17H24BrClIN5 |
| Molecular Weight | 540.68 g/mol |
| Exact Mass | 538.99 |
| IUPAC Name | 2-[(4-bromo-2-chlorophenyl)methyl]-1-ethyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(Br)cc1Cl)NCc1c(C)nn(C)c1C.I |
| InChI | InChI=1S/C17H23BrClN5.HI/c1-5-20-17(21-9-13-6-7-14(18)8-16(13)19)22-10-15-11(2)23-24(4)12(15)3;/h6-8H,5,9-10H2,1-4H3,(H2,20,21,22);1H |
| InChIKey | PHCNTHTZARLKKW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.68 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|