About 7-chloro-3,3-dimethyl-1,4-dihydroquinoxalin-2-one
7-chloro-3,3-dimethyl-1,4-dihydroquinoxalin-2-one (PubChem CID 11195186) has the molecular formula C10H11ClN2O
and a molecular weight of 210.66 g/mol. Its IUPAC name is 7-chloro-3,3-dimethyl-1,4-dihydroquinoxalin-2-one.
Molecular Properties
| Compound Name | 7-chloro-3,3-dimethyl-1,4-dihydroquinoxalin-2-one |
| PubChem CID | 11195186 |
| Molecular Formula | C10H11ClN2O |
| Molecular Weight | 210.66 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 7-chloro-3,3-dimethyl-1,4-dihydroquinoxalin-2-one |
| SMILES | CC1(C)Nc2ccc(Cl)cc2NC1=O |
| InChI | InChI=1S/C10H11ClN2O/c1-10(2)9(14)12-8-5-6(11)3-4-7(8)13-10/h3-5,13H,1-2H3,(H,12,14) |
| InChIKey | JZBNICJDZHMAFK-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.66 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-chloro-3,3-dimethyl-1,4-dihydroquinoxalin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-3,3-dimethyl-1,4-dihydroquinoxalin-2-one?
The IUPAC name of 7-chloro-3,3-dimethyl-1,4-dihydroquinoxalin-2-one (CID 11195186) is 7-chloro-3,3-dimethyl-1,4-dihydroquinoxalin-2-one.
What is the SMILES notation for 7-chloro-3,3-dimethyl-1,4-dihydroquinoxalin-2-one?
The canonical SMILES for 7-chloro-3,3-dimethyl-1,4-dihydroquinoxalin-2-one is CC1(C)Nc2ccc(Cl)cc2NC1=O.
What is the InChIKey of 7-chloro-3,3-dimethyl-1,4-dihydroquinoxalin-2-one?
The InChIKey is JZBNICJDZHMAFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClN2O/c1-10(2)9(14)12-8-5-6(11)3-4-7(8)13-10/h3-5,13H,1-2H3,(H,12,14).
What are the key properties of 7-chloro-3,3-dimethyl-1,4-dihydroquinoxalin-2-one?
7-chloro-3,3-dimethyl-1,4-dihydroquinoxalin-2-one has a molecular weight of 210.66 g/mol, XLogP of 2.48, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-3,3-dimethyl-1,4-dihydroquinoxalin-2-one is sourced from PubChem (CID 11195186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).