About 2-amino-3-bromoprop-1-ene-1,1,3-tricarbonitrile
2-amino-3-bromoprop-1-ene-1,1,3-tricarbonitrile (PubChem CID 11195191) has the molecular formula C6H3BrN4
and a molecular weight of 211.02 g/mol. Its IUPAC name is 2-amino-3-bromoprop-1-ene-1,1,3-tricarbonitrile.
Molecular Properties
| Compound Name | 2-amino-3-bromoprop-1-ene-1,1,3-tricarbonitrile |
| PubChem CID | 11195191 |
| Molecular Formula | C6H3BrN4 |
| Molecular Weight | 211.02 g/mol |
| Exact Mass | 209.95 |
| IUPAC Name | 2-amino-3-bromoprop-1-ene-1,1,3-tricarbonitrile |
| SMILES | N#CC(C#N)=C(N)C(Br)C#N |
| InChI | InChI=1S/C6H3BrN4/c7-5(3-10)6(11)4(1-8)2-9/h5H,11H2 |
| InChIKey | MMIJDAROUZCRFP-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.02 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-bromoprop-1-ene-1,1,3-tricarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-bromoprop-1-ene-1,1,3-tricarbonitrile?
The IUPAC name of 2-amino-3-bromoprop-1-ene-1,1,3-tricarbonitrile (CID 11195191) is 2-amino-3-bromoprop-1-ene-1,1,3-tricarbonitrile.
What is the SMILES notation for 2-amino-3-bromoprop-1-ene-1,1,3-tricarbonitrile?
The canonical SMILES for 2-amino-3-bromoprop-1-ene-1,1,3-tricarbonitrile is N#CC(C#N)=C(N)C(Br)C#N.
What is the InChIKey of 2-amino-3-bromoprop-1-ene-1,1,3-tricarbonitrile?
The InChIKey is MMIJDAROUZCRFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3BrN4/c7-5(3-10)6(11)4(1-8)2-9/h5H,11H2.
What are the key properties of 2-amino-3-bromoprop-1-ene-1,1,3-tricarbonitrile?
2-amino-3-bromoprop-1-ene-1,1,3-tricarbonitrile has a molecular weight of 211.02 g/mol, XLogP of 0.53, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-bromoprop-1-ene-1,1,3-tricarbonitrile is sourced from PubChem (CID 11195191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).