C23H36N6O2 — CID 111952977
1-ethyl-2-[[2-(2-morpholin-4-ylethoxy)phenyl]methyl]-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine (PubChem CID 111952977) has the molecular formula C23H36N6O2 and a molecular weight of 428.58 g/mol. Its IUPAC name is 1-ethyl-2-[[2-(2-morpholin-4-ylethoxy)phenyl]methyl]-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine.
| Compound Name | 1-ethyl-2-[[2-(2-morpholin-4-ylethoxy)phenyl]methyl]-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111952977 |
| Molecular Formula | C23H36N6O2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | 1-ethyl-2-[[2-(2-morpholin-4-ylethoxy)phenyl]methyl]-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccccc1OCCN1CCOCC1)NCc1c(C)nn(C)c1C |
| InChI | InChI=1S/C23H36N6O2/c1-5-24-23(26-17-21-18(2)27-28(4)19(21)3)25-16-20-8-6-7-9-22(20)31-15-12-29-10-13-30-14-11-29/h6-9H,5,10-17H2,1-4H3,(H2,24,25,26) |
| InChIKey | OBRUCKCEPYGIKJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|