C13H21N7 — CID 111953417
1-ethyl-2,3-bis[(2-methylpyrazol-3-yl)methyl]guanidine (PubChem CID 111953417) has the molecular formula C13H21N7 and a molecular weight of 275.36 g/mol. Its IUPAC name is 1-ethyl-2,3-bis[(2-methylpyrazol-3-yl)methyl]guanidine.
| Compound Name | 1-ethyl-2,3-bis[(2-methylpyrazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111953417 |
| Molecular Formula | C13H21N7 |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 1-ethyl-2,3-bis[(2-methylpyrazol-3-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccnn1C)NCc1ccnn1C |
| InChI | InChI=1S/C13H21N7/c1-4-14-13(15-9-11-5-7-17-19(11)2)16-10-12-6-8-18-20(12)3/h5-8H,4,9-10H2,1-3H3,(H2,14,15,16) |
| InChIKey | YPFVSFGKGSTIIT-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|