About N-benzyl-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methanimine
N-benzyl-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methanimine (PubChem CID 11195349) has the molecular formula C13H17NO2
and a molecular weight of 219.28 g/mol. Its IUPAC name is N-benzyl-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methanimine.
Molecular Properties
| Compound Name | N-benzyl-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methanimine |
| PubChem CID | 11195349 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | N-benzyl-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methanimine |
| SMILES | CC1(C)OC[C@@H](/C=N/Cc2ccccc2)O1 |
| InChI | InChI=1S/C13H17NO2/c1-13(2)15-10-12(16-13)9-14-8-11-6-4-3-5-7-11/h3-7,9,12H,8,10H2,1-2H3/b14-9+/t12-/m1/s1 |
| InChIKey | LQDPZICDFDXHQJ-ZMTLZGASSA-N |
| XLogP | 2.41 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methanimine?
The IUPAC name of N-benzyl-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methanimine (CID 11195349) is N-benzyl-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methanimine.
What is the SMILES notation for N-benzyl-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methanimine?
The canonical SMILES for N-benzyl-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methanimine is CC1(C)OC[C@@H](/C=N/Cc2ccccc2)O1.
What is the InChIKey of N-benzyl-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methanimine?
The InChIKey is LQDPZICDFDXHQJ-ZMTLZGASSA-N. The full InChI is InChI=1S/C13H17NO2/c1-13(2)15-10-12(16-13)9-14-8-11-6-4-3-5-7-11/h3-7,9,12H,8,10H2,1-2H3/b14-9+/t12-/m1/s1.
What are the key properties of N-benzyl-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methanimine?
N-benzyl-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methanimine has a molecular weight of 219.28 g/mol, XLogP of 2.41, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methanimine is sourced from PubChem (CID 11195349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).