C11H17NO4 — CID 11195506
methyl (2S,3S)-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]pyrrolidine-3-carboxylate (PubChem CID 11195506) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is methyl (2S,3S)-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]pyrrolidine-3-carboxylate.
| Compound Name | methyl (2S,3S)-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 11195506 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | methyl (2S,3S)-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]pyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)/C=C/[C@@H]1NCC[C@@H]1C(=O)OC |
| InChI | InChI=1S/C11H17NO4/c1-3-16-10(13)5-4-9-8(6-7-12-9)11(14)15-2/h4-5,8-9,12H,3,6-7H2,1-2H3/b5-4+/t8-,9-/m0/s1 |
| InChIKey | GORNJHCIRGYSEF-HXQNXIEXSA-N |
| XLogP | 0.26 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|