C11H20O3Si — CID 11195542
2-ethenoxy-4,4,5,5-tetramethyl-2-prop-2-enyl-1,3,2-dioxasilolane (PubChem CID 11195542) has the molecular formula C11H20O3Si and a molecular weight of 228.36 g/mol. Its IUPAC name is 2-ethenoxy-4,4,5,5-tetramethyl-2-prop-2-enyl-1,3,2-dioxasilolane.
| Compound Name | 2-ethenoxy-4,4,5,5-tetramethyl-2-prop-2-enyl-1,3,2-dioxasilolane |
|---|---|
| PubChem CID | 11195542 |
| Molecular Formula | C11H20O3Si |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 2-ethenoxy-4,4,5,5-tetramethyl-2-prop-2-enyl-1,3,2-dioxasilolane |
| SMILES | C=CC[Si]1(OC=C)OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C11H20O3Si/c1-7-9-15(12-8-2)13-10(3,4)11(5,6)14-15/h7-8H,1-2,9H2,3-6H3 |
| InChIKey | UGDXSQFIYSYLGG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|