About (Z)-tetradec-7-ene-5,10-diol
(Z)-tetradec-7-ene-5,10-diol (PubChem CID 11195544) has the molecular formula C14H28O2
and a molecular weight of 228.38 g/mol. Its IUPAC name is (Z)-tetradec-7-ene-5,10-diol.
Molecular Properties
| Compound Name | (Z)-tetradec-7-ene-5,10-diol |
| PubChem CID | 11195544 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | (Z)-tetradec-7-ene-5,10-diol |
| SMILES | CCCCC(O)C/C=C\CC(O)CCCC |
| InChI | InChI=1S/C14H28O2/c1-3-5-9-13(15)11-7-8-12-14(16)10-6-4-2/h7-8,13-16H,3-6,9-12H2,1-2H3/b8-7- |
| InChIKey | ILKPPUFXJIMGBU-FPLPWBNLSA-N |
| XLogP | 3.42 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-tetradec-7-ene-5,10-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-tetradec-7-ene-5,10-diol?
The IUPAC name of (Z)-tetradec-7-ene-5,10-diol (CID 11195544) is (Z)-tetradec-7-ene-5,10-diol.
What is the SMILES notation for (Z)-tetradec-7-ene-5,10-diol?
The canonical SMILES for (Z)-tetradec-7-ene-5,10-diol is CCCCC(O)C/C=C\CC(O)CCCC.
What is the InChIKey of (Z)-tetradec-7-ene-5,10-diol?
The InChIKey is ILKPPUFXJIMGBU-FPLPWBNLSA-N. The full InChI is InChI=1S/C14H28O2/c1-3-5-9-13(15)11-7-8-12-14(16)10-6-4-2/h7-8,13-16H,3-6,9-12H2,1-2H3/b8-7-.
What are the key properties of (Z)-tetradec-7-ene-5,10-diol?
(Z)-tetradec-7-ene-5,10-diol has a molecular weight of 228.38 g/mol, XLogP of 3.42, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-tetradec-7-ene-5,10-diol is sourced from PubChem (CID 11195544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).