C13H16N2O2 — CID 11195632
methyl (3aS,9bR)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-h]isoquinoline-1-carboxylate (PubChem CID 11195632) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is methyl (3aS,9bR)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-h]isoquinoline-1-carboxylate.
| Compound Name | methyl (3aS,9bR)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-h]isoquinoline-1-carboxylate |
|---|---|
| PubChem CID | 11195632 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | methyl (3aS,9bR)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-h]isoquinoline-1-carboxylate |
| SMILES | COC(=O)N1CC[C@@H]2CCc3ccncc3[C@@H]21 |
| InChI | InChI=1S/C13H16N2O2/c1-17-13(16)15-7-5-10-3-2-9-4-6-14-8-11(9)12(10)15/h4,6,8,10,12H,2-3,5,7H2,1H3/t10-,12+/m0/s1 |
| InChIKey | CKOYIMJBVVHQEG-CMPLNLGQSA-N |
| XLogP | 2.16 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |