C23H31N3O — CID 111958951
N-(2,2-diphenylethyl)-4-ethoxy-N'-methylpiperidine-1-carboximidamide (PubChem CID 111958951) has the molecular formula C23H31N3O and a molecular weight of 365.52 g/mol. Its IUPAC name is N-(2,2-diphenylethyl)-4-ethoxy-N'-methylpiperidine-1-carboximidamide.
| Compound Name | N-(2,2-diphenylethyl)-4-ethoxy-N'-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111958951 |
| Molecular Formula | C23H31N3O |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.25 |
| IUPAC Name | N-(2,2-diphenylethyl)-4-ethoxy-N'-methylpiperidine-1-carboximidamide |
| SMILES | CCOC1CCN(/C(=N/C)NCC(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C23H31N3O/c1-3-27-21-14-16-26(17-15-21)23(24-2)25-18-22(19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-13,21-22H,3,14-18H2,1-2H3,(H,24,25) |
| InChIKey | QBQKQAPTKULCRT-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|