C22H35N3O3 — CID 111959667
N-[(4-cyclopentyloxy-3-methoxyphenyl)methyl]-4-ethoxy-N'-methylpiperidine-1-carboximidamide (PubChem CID 111959667) has the molecular formula C22H35N3O3 and a molecular weight of 389.54 g/mol. Its IUPAC name is N-[(4-cyclopentyloxy-3-methoxyphenyl)methyl]-4-ethoxy-N'-methylpiperidine-1-carboximidamide.
| Compound Name | N-[(4-cyclopentyloxy-3-methoxyphenyl)methyl]-4-ethoxy-N'-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111959667 |
| Molecular Formula | C22H35N3O3 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.27 |
| IUPAC Name | N-[(4-cyclopentyloxy-3-methoxyphenyl)methyl]-4-ethoxy-N'-methylpiperidine-1-carboximidamide |
| SMILES | CCOC1CCN(/C(=N\C)NCc2ccc(OC3CCCC3)c(OC)c2)CC1 |
| InChI | InChI=1S/C22H35N3O3/c1-4-27-18-11-13-25(14-12-18)22(23-2)24-16-17-9-10-20(21(15-17)26-3)28-19-7-5-6-8-19/h9-10,15,18-19H,4-8,11-14,16H2,1-3H3,(H,23,24) |
| InChIKey | SPDQYLQTDQWNEQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|