C17H28N4O3S — CID 111959821
4-ethoxy-N'-methyl-N-[[4-(methylsulfamoyl)phenyl]methyl]piperidine-1-carboximidamide (PubChem CID 111959821) has the molecular formula C17H28N4O3S and a molecular weight of 368.50 g/mol. Its IUPAC name is 4-ethoxy-N'-methyl-N-[[4-(methylsulfamoyl)phenyl]methyl]piperidine-1-carboximidamide.
| Compound Name | 4-ethoxy-N'-methyl-N-[[4-(methylsulfamoyl)phenyl]methyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111959821 |
| Molecular Formula | C17H28N4O3S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | 4-ethoxy-N'-methyl-N-[[4-(methylsulfamoyl)phenyl]methyl]piperidine-1-carboximidamide |
| SMILES | CCOC1CCN(/C(=N\C)NCc2ccc(S(=O)(=O)NC)cc2)CC1 |
| InChI | InChI=1S/C17H28N4O3S/c1-4-24-15-9-11-21(12-10-15)17(18-2)20-13-14-5-7-16(8-6-14)25(22,23)19-3/h5-8,15,19H,4,9-13H2,1-3H3,(H,18,20) |
| InChIKey | OOVKFZTWBYUJHQ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|