C11H15BrMg — CID 11196065
magnesium;1,2,3,4,5-pentamethylbenzene-6-ide;bromide (PubChem CID 11196065) has the molecular formula C11H15BrMg and a molecular weight of 251.45 g/mol. Its IUPAC name is magnesium;1,2,3,4,5-pentamethylbenzene-6-ide;bromide.
| Compound Name | magnesium;1,2,3,4,5-pentamethylbenzene-6-ide;bromide |
|---|---|
| PubChem CID | 11196065 |
| Molecular Formula | C11H15BrMg |
| Molecular Weight | 251.45 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | magnesium;1,2,3,4,5-pentamethylbenzene-6-ide;bromide |
| SMILES | Cc1[c-]c(C)c(C)c(C)c1C.[Br-].[Mg+2] |
| InChI | InChI=1S/C11H15.BrH.Mg/c1-7-6-8(2)10(4)11(5)9(7)3;;/h1-5H3;1H;/q-1;;+2/p-1 |
| InChIKey | XYFPEXRRQAUBAC-UHFFFAOYSA-M |
| XLogP | -0.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.45 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|