C15H26O3 — CID 11196116
cis-(1S,3R)-2,2-dimethyl-3-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-4-methylidenecyclohexan-1-ol (PubChem CID 11196116) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is cis-(1S,3R)-2,2-dimethyl-3-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-4-methylidenecyclohexan-1-ol.
| Compound Name | cis-(1S,3R)-2,2-dimethyl-3-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-4-methylidenecyclohexan-1-ol |
|---|---|
| PubChem CID | 11196116 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | cis-(1S,3R)-2,2-dimethyl-3-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-4-methylidenecyclohexan-1-ol |
| SMILES | C=C1CC[C@H](O)C(C)(C)[C@@H]1CCC1(C)OCCO1 |
| InChI | InChI=1S/C15H26O3/c1-11-5-6-13(16)14(2,3)12(11)7-8-15(4)17-9-10-18-15/h12-13,16H,1,5-10H2,2-4H3/t12-,13+/m1/s1 |
| InChIKey | WWIAOGXZYFHMPU-OLZOCXBDSA-N |
| XLogP | 2.88 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|