About (5R)-3-pyridin-2-ylspiro[1,3-oxazolidine-5,3'-1-azabicyclo[2.2.2]octane]-2-one
(5R)-3-pyridin-2-ylspiro[1,3-oxazolidine-5,3'-1-azabicyclo[2.2.2]octane]-2-one (PubChem CID 11196221) has the molecular formula C14H17N3O2
and a molecular weight of 259.31 g/mol. Its IUPAC name is (5R)-3-pyridin-2-ylspiro[1,3-oxazolidine-5,3'-1-azabicyclo[2.2.2]octane]-2-one.
Molecular Properties
| Compound Name | (5R)-3-pyridin-2-ylspiro[1,3-oxazolidine-5,3'-1-azabicyclo[2.2.2]octane]-2-one |
| PubChem CID | 11196221 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | (5R)-3-pyridin-2-ylspiro[1,3-oxazolidine-5,3'-1-azabicyclo[2.2.2]octane]-2-one |
| SMILES | O=C1O[C@]2(CN3CCC2CC3)CN1c1ccccn1 |
| InChI | InChI=1S/C14H17N3O2/c18-13-17(12-3-1-2-6-15-12)10-14(19-13)9-16-7-4-11(14)5-8-16/h1-3,6,11H,4-5,7-10H2/t14-/m1/s1 |
| InChIKey | OCLBPMPJMWINMQ-CQSZACIVSA-N |
| XLogP | 1.50 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5R)-3-pyridin-2-ylspiro[1,3-oxazolidine-5,3'-1-azabicyclo[2.2.2]octane]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-3-pyridin-2-ylspiro[1,3-oxazolidine-5,3'-1-azabicyclo[2.2.2]octane]-2-one?
The IUPAC name of (5R)-3-pyridin-2-ylspiro[1,3-oxazolidine-5,3'-1-azabicyclo[2.2.2]octane]-2-one (CID 11196221) is (5R)-3-pyridin-2-ylspiro[1,3-oxazolidine-5,3'-1-azabicyclo[2.2.2]octane]-2-one.
What is the SMILES notation for (5R)-3-pyridin-2-ylspiro[1,3-oxazolidine-5,3'-1-azabicyclo[2.2.2]octane]-2-one?
The canonical SMILES for (5R)-3-pyridin-2-ylspiro[1,3-oxazolidine-5,3'-1-azabicyclo[2.2.2]octane]-2-one is O=C1O[C@]2(CN3CCC2CC3)CN1c1ccccn1.
What is the InChIKey of (5R)-3-pyridin-2-ylspiro[1,3-oxazolidine-5,3'-1-azabicyclo[2.2.2]octane]-2-one?
The InChIKey is OCLBPMPJMWINMQ-CQSZACIVSA-N. The full InChI is InChI=1S/C14H17N3O2/c18-13-17(12-3-1-2-6-15-12)10-14(19-13)9-16-7-4-11(14)5-8-16/h1-3,6,11H,4-5,7-10H2/t14-/m1/s1.
What are the key properties of (5R)-3-pyridin-2-ylspiro[1,3-oxazolidine-5,3'-1-azabicyclo[2.2.2]octane]-2-one?
(5R)-3-pyridin-2-ylspiro[1,3-oxazolidine-5,3'-1-azabicyclo[2.2.2]octane]-2-one has a molecular weight of 259.31 g/mol, XLogP of 1.50, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-3-pyridin-2-ylspiro[1,3-oxazolidine-5,3'-1-azabicyclo[2.2.2]octane]-2-one is sourced from PubChem (CID 11196221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).