C15H22O4 — CID 11196392
(4R,5R)-4,5-bis[(1E)-2-methoxybuta-1,3-dienyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 11196392) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is (4R,5R)-4,5-bis[(1E)-2-methoxybuta-1,3-dienyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4R,5R)-4,5-bis[(1E)-2-methoxybuta-1,3-dienyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 11196392 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (4R,5R)-4,5-bis[(1E)-2-methoxybuta-1,3-dienyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | C=C/C(=C\[C@H]1OC(C)(C)O[C@@H]1/C=C(\C=C)OC)OC |
| InChI | InChI=1S/C15H22O4/c1-7-11(16-5)9-13-14(10-12(8-2)17-6)19-15(3,4)18-13/h7-10,13-14H,1-2H2,3-6H3/b11-9+,12-10+/t13-,14-/m1/s1 |
| InChIKey | DNWMCVRNOYPLPA-SCXCSFDHSA-N |
| XLogP | 2.94 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|