C17H27N5O2S — CID 111965239
2-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-1-ethyl-3-[3-(furan-2-ylmethoxy)propyl]guanidine (PubChem CID 111965239) has the molecular formula C17H27N5O2S and a molecular weight of 365.50 g/mol. Its IUPAC name is 2-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-1-ethyl-3-[3-(furan-2-ylmethoxy)propyl]guanidine.
| Compound Name | 2-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-1-ethyl-3-[3-(furan-2-ylmethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111965239 |
| Molecular Formula | C17H27N5O2S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 2-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-1-ethyl-3-[3-(furan-2-ylmethoxy)propyl]guanidine |
| SMILES | CCN/C(=N\Cc1csc(N(C)C)n1)NCCCOCc1ccco1 |
| InChI | InChI=1S/C17H27N5O2S/c1-4-18-16(20-11-14-13-25-17(21-14)22(2)3)19-8-6-9-23-12-15-7-5-10-24-15/h5,7,10,13H,4,6,8-9,11-12H2,1-3H3,(H2,18,19,20) |
| InChIKey | AKHZLXHDXBYNJE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 74.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|