C18H28F2N4O — CID 111965687
1-[2-(2,5-difluorophenyl)ethyl]-2-methyl-3-(2-methyl-2-morpholin-4-ylpropyl)guanidine (PubChem CID 111965687) has the molecular formula C18H28F2N4O and a molecular weight of 354.45 g/mol. Its IUPAC name is 1-[2-(2,5-difluorophenyl)ethyl]-2-methyl-3-(2-methyl-2-morpholin-4-ylpropyl)guanidine.
| Compound Name | 1-[2-(2,5-difluorophenyl)ethyl]-2-methyl-3-(2-methyl-2-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111965687 |
| Molecular Formula | C18H28F2N4O |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 1-[2-(2,5-difluorophenyl)ethyl]-2-methyl-3-(2-methyl-2-morpholin-4-ylpropyl)guanidine |
| SMILES | C/N=C(/NCCc1cc(F)ccc1F)NCC(C)(C)N1CCOCC1 |
| InChI | InChI=1S/C18H28F2N4O/c1-18(2,24-8-10-25-11-9-24)13-23-17(21-3)22-7-6-14-12-15(19)4-5-16(14)20/h4-5,12H,6-11,13H2,1-3H3,(H2,21,22,23) |
| InChIKey | NYWKUWANJMKLLV-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|