C17H25F2N3O — CID 111965827
1-[3-(cyclopropylmethoxy)propyl]-3-[2-(2,5-difluorophenyl)ethyl]-2-methylguanidine (PubChem CID 111965827) has the molecular formula C17H25F2N3O and a molecular weight of 325.40 g/mol. Its IUPAC name is 1-[3-(cyclopropylmethoxy)propyl]-3-[2-(2,5-difluorophenyl)ethyl]-2-methylguanidine.
| Compound Name | 1-[3-(cyclopropylmethoxy)propyl]-3-[2-(2,5-difluorophenyl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111965827 |
| Molecular Formula | C17H25F2N3O |
| Molecular Weight | 325.40 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 1-[3-(cyclopropylmethoxy)propyl]-3-[2-(2,5-difluorophenyl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCCOCC1CC1)NCCc1cc(F)ccc1F |
| InChI | InChI=1S/C17H25F2N3O/c1-20-17(21-8-2-10-23-12-13-3-4-13)22-9-7-14-11-15(18)5-6-16(14)19/h5-6,11,13H,2-4,7-10,12H2,1H3,(H2,20,21,22) |
| InChIKey | FJYXXJUMTULMRV-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.40 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|