C20H35N5O2S — CID 111966397
2-[[butylamino-[[2-(5-methylthiophen-2-yl)-2-morpholin-4-ylethyl]amino]methylidene]amino]-N,N-dimethylacetamide (PubChem CID 111966397) has the molecular formula C20H35N5O2S and a molecular weight of 409.60 g/mol. Its IUPAC name is 2-[[butylamino-[[2-(5-methylthiophen-2-yl)-2-morpholin-4-ylethyl]amino]methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[butylamino-[[2-(5-methylthiophen-2-yl)-2-morpholin-4-ylethyl]amino]methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 111966397 |
| Molecular Formula | C20H35N5O2S |
| Molecular Weight | 409.60 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | 2-[[butylamino-[[2-(5-methylthiophen-2-yl)-2-morpholin-4-ylethyl]amino]methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CCCCN/C(=N\CC(=O)N(C)C)NCC(c1ccc(C)s1)N1CCOCC1 |
| InChI | InChI=1S/C20H35N5O2S/c1-5-6-9-21-20(23-15-19(26)24(3)4)22-14-17(18-8-7-16(2)28-18)25-10-12-27-13-11-25/h7-8,17H,5-6,9-15H2,1-4H3,(H2,21,22,23) |
| InChIKey | RMTWFNPGDJZCJI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.60 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|