C21H25IN4OS — CID 111966594
1-ethyl-3-[[4-(4-methoxyphenyl)thiophen-2-yl]methyl]-2-(pyridin-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111966594) has the molecular formula C21H25IN4OS and a molecular weight of 508.43 g/mol. Its IUPAC name is 1-ethyl-3-[[4-(4-methoxyphenyl)thiophen-2-yl]methyl]-2-(pyridin-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[[4-(4-methoxyphenyl)thiophen-2-yl]methyl]-2-(pyridin-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111966594 |
| Molecular Formula | C21H25IN4OS |
| Molecular Weight | 508.43 g/mol |
| Exact Mass | 508.08 |
| IUPAC Name | 1-ethyl-3-[[4-(4-methoxyphenyl)thiophen-2-yl]methyl]-2-(pyridin-2-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccn1)NCc1cc(-c2ccc(OC)cc2)cs1.I |
| InChI | InChI=1S/C21H24N4OS.HI/c1-3-22-21(24-13-18-6-4-5-11-23-18)25-14-20-12-17(15-27-20)16-7-9-19(26-2)10-8-16;/h4-12,15H,3,13-14H2,1-2H3,(H2,22,24,25);1H |
| InChIKey | AIVOZPGNLYHJGJ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.43 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|