C16H32IN3O2S — CID 111967118
1-[2-(cyclohexen-1-yl)ethyl]-3-ethyl-2-(2-methyl-2-methylsulfonylpropyl)guanidine;hydroiodide (PubChem CID 111967118) has the molecular formula C16H32IN3O2S and a molecular weight of 457.42 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-3-ethyl-2-(2-methyl-2-methylsulfonylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-ethyl-2-(2-methyl-2-methylsulfonylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111967118 |
| Molecular Formula | C16H32IN3O2S |
| Molecular Weight | 457.42 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-ethyl-2-(2-methyl-2-methylsulfonylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)S(C)(=O)=O)NCCC1=CCCCC1.I |
| InChI | InChI=1S/C16H31N3O2S.HI/c1-5-17-15(19-13-16(2,3)22(4,20)21)18-12-11-14-9-7-6-8-10-14;/h9H,5-8,10-13H2,1-4H3,(H2,17,18,19);1H |
| InChIKey | JGWQAMDSMBXQRN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|