C11H20S4 — CID 11196758
2-[3-(1,3-dithian-2-yl)propyl]-1,3-dithiane (PubChem CID 11196758) has the molecular formula C11H20S4 and a molecular weight of 280.55 g/mol. Its IUPAC name is 2-[3-(1,3-dithian-2-yl)propyl]-1,3-dithiane.
| Compound Name | 2-[3-(1,3-dithian-2-yl)propyl]-1,3-dithiane |
|---|---|
| PubChem CID | 11196758 |
| Molecular Formula | C11H20S4 |
| Molecular Weight | 280.55 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 2-[3-(1,3-dithian-2-yl)propyl]-1,3-dithiane |
| SMILES | C1CSC(CCCC2SCCCS2)SC1 |
| InChI | InChI=1S/C11H20S4/c1(4-10-12-6-2-7-13-10)5-11-14-8-3-9-15-11/h10-11H,1-9H2 |
| InChIKey | VLYZDYMURIOJJP-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.55 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |