C24H37IN4O2 — CID 111967612
2-[3-(1-benzylpiperidin-4-yl)oxypropyl]-1-ethyl-3-[2-(furan-2-yl)ethyl]guanidine;hydroiodide (PubChem CID 111967612) has the molecular formula C24H37IN4O2 and a molecular weight of 540.49 g/mol. Its IUPAC name is 2-[3-(1-benzylpiperidin-4-yl)oxypropyl]-1-ethyl-3-[2-(furan-2-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[3-(1-benzylpiperidin-4-yl)oxypropyl]-1-ethyl-3-[2-(furan-2-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111967612 |
| Molecular Formula | C24H37IN4O2 |
| Molecular Weight | 540.49 g/mol |
| Exact Mass | 540.20 |
| IUPAC Name | 2-[3-(1-benzylpiperidin-4-yl)oxypropyl]-1-ethyl-3-[2-(furan-2-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCOC1CCN(Cc2ccccc2)CC1)NCCc1ccco1.I |
| InChI | InChI=1S/C24H36N4O2.HI/c1-2-25-24(27-15-11-22-10-6-18-29-22)26-14-7-19-30-23-12-16-28(17-13-23)20-21-8-4-3-5-9-21;/h3-6,8-10,18,23H,2,7,11-17,19-20H2,1H3,(H2,25,26,27);1H |
| InChIKey | LSOPCTHGHYQSQA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 62.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|