About cis-(2R,3R)-2-anilinooxy-3-phenylcyclohexan-1-one
cis-(2R,3R)-2-anilinooxy-3-phenylcyclohexan-1-one (PubChem CID 11196774) has the molecular formula C18H19NO2
and a molecular weight of 281.36 g/mol. Its IUPAC name is cis-(2R,3R)-2-anilinooxy-3-phenylcyclohexan-1-one.
Molecular Properties
| Compound Name | cis-(2R,3R)-2-anilinooxy-3-phenylcyclohexan-1-one |
| PubChem CID | 11196774 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | cis-(2R,3R)-2-anilinooxy-3-phenylcyclohexan-1-one |
| SMILES | O=C1CCC[C@H](c2ccccc2)[C@H]1ONc1ccccc1 |
| InChI | InChI=1S/C18H19NO2/c20-17-13-7-12-16(14-8-3-1-4-9-14)18(17)21-19-15-10-5-2-6-11-15/h1-6,8-11,16,18-19H,7,12-13H2/t16-,18-/m1/s1 |
| InChIKey | YUERTCUDIIETRZ-SJLPKXTDSA-N |
| XLogP | 3.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze cis-(2R,3R)-2-anilinooxy-3-phenylcyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(2R,3R)-2-anilinooxy-3-phenylcyclohexan-1-one?
The IUPAC name of cis-(2R,3R)-2-anilinooxy-3-phenylcyclohexan-1-one (CID 11196774) is cis-(2R,3R)-2-anilinooxy-3-phenylcyclohexan-1-one.
What is the SMILES notation for cis-(2R,3R)-2-anilinooxy-3-phenylcyclohexan-1-one?
The canonical SMILES for cis-(2R,3R)-2-anilinooxy-3-phenylcyclohexan-1-one is O=C1CCC[C@H](c2ccccc2)[C@H]1ONc1ccccc1.
What is the InChIKey of cis-(2R,3R)-2-anilinooxy-3-phenylcyclohexan-1-one?
The InChIKey is YUERTCUDIIETRZ-SJLPKXTDSA-N. The full InChI is InChI=1S/C18H19NO2/c20-17-13-7-12-16(14-8-3-1-4-9-14)18(17)21-19-15-10-5-2-6-11-15/h1-6,8-11,16,18-19H,7,12-13H2/t16-,18-/m1/s1.
What are the key properties of cis-(2R,3R)-2-anilinooxy-3-phenylcyclohexan-1-one?
cis-(2R,3R)-2-anilinooxy-3-phenylcyclohexan-1-one has a molecular weight of 281.36 g/mol, XLogP of 3.94, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(2R,3R)-2-anilinooxy-3-phenylcyclohexan-1-one is sourced from PubChem (CID 11196774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).