C20H28N4O2S — CID 111967817
N-tert-butyl-2-[[N-[[5-(4-methoxyphenyl)thiophen-2-yl]methyl]-N'-methylcarbamimidoyl]amino]acetamide (PubChem CID 111967817) has the molecular formula C20H28N4O2S and a molecular weight of 388.54 g/mol. Its IUPAC name is N-tert-butyl-2-[[N-[[5-(4-methoxyphenyl)thiophen-2-yl]methyl]-N'-methylcarbamimidoyl]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[N-[[5-(4-methoxyphenyl)thiophen-2-yl]methyl]-N'-methylcarbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111967817 |
| Molecular Formula | C20H28N4O2S |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | N-tert-butyl-2-[[N-[[5-(4-methoxyphenyl)thiophen-2-yl]methyl]-N'-methylcarbamimidoyl]amino]acetamide |
| SMILES | C/N=C(\NCC(=O)NC(C)(C)C)NCc1ccc(-c2ccc(OC)cc2)s1 |
| InChI | InChI=1S/C20H28N4O2S/c1-20(2,3)24-18(25)13-23-19(21-4)22-12-16-10-11-17(27-16)14-6-8-15(26-5)9-7-14/h6-11H,12-13H2,1-5H3,(H,24,25)(H2,21,22,23) |
| InChIKey | NYGZCZUWSBPQGA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|