C15H22O5 — CID 11196797
(2R)-2-[(4R,5R)-5-[(Z,1R)-1-hydroxypent-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3-dihydropyran-6-one (PubChem CID 11196797) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is (2R)-2-[(4R,5R)-5-[(Z,1R)-1-hydroxypent-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3-dihydropyran-6-one.
| Compound Name | (2R)-2-[(4R,5R)-5-[(Z,1R)-1-hydroxypent-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 11196797 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | (2R)-2-[(4R,5R)-5-[(Z,1R)-1-hydroxypent-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3-dihydropyran-6-one |
| SMILES | C/C=C\C[C@@H](O)[C@H]1OC(C)(C)O[C@@H]1[C@H]1CC=CC(=O)O1 |
| InChI | InChI=1S/C15H22O5/c1-4-5-7-10(16)13-14(20-15(2,3)19-13)11-8-6-9-12(17)18-11/h4-6,9-11,13-14,16H,7-8H2,1-3H3/b5-4-/t10-,11-,13-,14-/m1/s1 |
| InChIKey | MFRGQDOPWVTBLL-XKRGKWIDSA-N |
| XLogP | 1.71 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|