C19H37F3IN5O — CID 111968096
1-ethyl-2-(3-morpholin-4-ylpropyl)-3-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine;hydroiodide (PubChem CID 111968096) has the molecular formula C19H37F3IN5O and a molecular weight of 535.44 g/mol. Its IUPAC name is 1-ethyl-2-(3-morpholin-4-ylpropyl)-3-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(3-morpholin-4-ylpropyl)-3-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111968096 |
| Molecular Formula | C19H37F3IN5O |
| Molecular Weight | 535.44 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | 1-ethyl-2-(3-morpholin-4-ylpropyl)-3-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCN1CCOCC1)NCCC1CCN(CC(F)(F)F)CC1.I |
| InChI | InChI=1S/C19H36F3N5O.HI/c1-2-23-18(24-7-3-9-26-12-14-28-15-13-26)25-8-4-17-5-10-27(11-6-17)16-19(20,21)22;/h17H,2-16H2,1H3,(H2,23,24,25);1H |
| InChIKey | FZTLKDRJURXUHV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|