C19H33F3N4 — CID 111968545
1-[2-(cyclohexen-1-yl)ethyl]-2-methyl-3-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine (PubChem CID 111968545) has the molecular formula C19H33F3N4 and a molecular weight of 374.50 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-2-methyl-3-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-2-methyl-3-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 111968545 |
| Molecular Formula | C19H33F3N4 |
| Molecular Weight | 374.50 g/mol |
| Exact Mass | 374.27 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-2-methyl-3-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine |
| SMILES | C/N=C(\NCCC1=CCCCC1)NCCC1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C19H33F3N4/c1-23-18(24-11-7-16-5-3-2-4-6-16)25-12-8-17-9-13-26(14-10-17)15-19(20,21)22/h5,17H,2-4,6-15H2,1H3,(H2,23,24,25) |
| InChIKey | NIBZNJHEPBWBBO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.50 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|