C19H28F4N4 — CID 111968721
1-ethyl-2-[(2-fluorophenyl)methyl]-3-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine (PubChem CID 111968721) has the molecular formula C19H28F4N4 and a molecular weight of 388.45 g/mol. Its IUPAC name is 1-ethyl-2-[(2-fluorophenyl)methyl]-3-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine.
| Compound Name | 1-ethyl-2-[(2-fluorophenyl)methyl]-3-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 111968721 |
| Molecular Formula | C19H28F4N4 |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | 1-ethyl-2-[(2-fluorophenyl)methyl]-3-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccccc1F)NCCC1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C19H28F4N4/c1-2-24-18(26-13-16-5-3-4-6-17(16)20)25-10-7-15-8-11-27(12-9-15)14-19(21,22)23/h3-6,15H,2,7-14H2,1H3,(H2,24,25,26) |
| InChIKey | VNTSXYHHMHMEJA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|