C21H29F3N4OS — CID 111968921
1-[2-(furan-2-yl)ethyl]-2-(thiophen-2-ylmethyl)-3-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine (PubChem CID 111968921) has the molecular formula C21H29F3N4OS and a molecular weight of 442.55 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-2-(thiophen-2-ylmethyl)-3-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-2-(thiophen-2-ylmethyl)-3-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 111968921 |
| Molecular Formula | C21H29F3N4OS |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-2-(thiophen-2-ylmethyl)-3-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine |
| SMILES | FC(F)(F)CN1CCC(CCN/C(=N/Cc2cccs2)NCCc2ccco2)CC1 |
| InChI | InChI=1S/C21H29F3N4OS/c22-21(23,24)16-28-11-7-17(8-12-28)5-9-25-20(27-15-19-4-2-14-30-19)26-10-6-18-3-1-13-29-18/h1-4,13-14,17H,5-12,15-16H2,(H2,25,26,27) |
| InChIKey | FHGSCEJJRHOMHM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 52.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|