C17H19NO3 — CID 11196901
(3R,4S)-4-[(1R)-1-hydroxy-2-phenylbuta-2,3-dienyl]-3-methoxy-1-prop-2-enylazetidin-2-one (PubChem CID 11196901) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is (3R,4S)-4-[(1R)-1-hydroxy-2-phenylbuta-2,3-dienyl]-3-methoxy-1-prop-2-enylazetidin-2-one.
| Compound Name | (3R,4S)-4-[(1R)-1-hydroxy-2-phenylbuta-2,3-dienyl]-3-methoxy-1-prop-2-enylazetidin-2-one |
|---|---|
| PubChem CID | 11196901 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | (3R,4S)-4-[(1R)-1-hydroxy-2-phenylbuta-2,3-dienyl]-3-methoxy-1-prop-2-enylazetidin-2-one |
| SMILES | C=C=C(c1ccccc1)[C@@H](O)[C@H]1[C@@H](OC)C(=O)N1CC=C |
| InChI | InChI=1S/C17H19NO3/c1-4-11-18-14(16(21-3)17(18)20)15(19)13(5-2)12-9-7-6-8-10-12/h4,6-10,14-16,19H,1-2,11H2,3H3/t14-,15+,16+/m0/s1 |
| InChIKey | PHCUIGDMNKAIKV-ARFHVFGLSA-N |
| XLogP | 1.63 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|