C13H19N3OS — CID 111969416
1-(1H-indazol-7-ylmethylamino)-2-methyl-3-methylsulfanylpropan-2-ol (PubChem CID 111969416) has the molecular formula C13H19N3OS and a molecular weight of 265.38 g/mol. Its IUPAC name is 1-(1H-indazol-7-ylmethylamino)-2-methyl-3-methylsulfanylpropan-2-ol.
| Compound Name | 1-(1H-indazol-7-ylmethylamino)-2-methyl-3-methylsulfanylpropan-2-ol |
|---|---|
| PubChem CID | 111969416 |
| Molecular Formula | C13H19N3OS |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 1-(1H-indazol-7-ylmethylamino)-2-methyl-3-methylsulfanylpropan-2-ol |
| SMILES | CSCC(C)(O)CNCc1cccc2cn[nH]c12 |
| InChI | InChI=1S/C13H19N3OS/c1-13(17,9-18-2)8-14-6-10-4-3-5-11-7-15-16-12(10)11/h3-5,7,14,17H,6,8-9H2,1-2H3,(H,15,16) |
| InChIKey | ZJGJMRJYQDCNBI-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |