C15H16FN3O3 — CID 111969897
[1-(4-fluorophenyl)-4-hydroxypyrazol-3-yl]-(3-hydroxypiperidin-1-yl)methanone (PubChem CID 111969897) has the molecular formula C15H16FN3O3 and a molecular weight of 305.31 g/mol. Its IUPAC name is [1-(4-fluorophenyl)-4-hydroxypyrazol-3-yl]-(3-hydroxypiperidin-1-yl)methanone.
| Compound Name | [1-(4-fluorophenyl)-4-hydroxypyrazol-3-yl]-(3-hydroxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 111969897 |
| Molecular Formula | C15H16FN3O3 |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | [1-(4-fluorophenyl)-4-hydroxypyrazol-3-yl]-(3-hydroxypiperidin-1-yl)methanone |
| SMILES | O=C(c1nn(-c2ccc(F)cc2)cc1O)N1CCCC(O)C1 |
| InChI | InChI=1S/C15H16FN3O3/c16-10-3-5-11(6-4-10)19-9-13(21)14(17-19)15(22)18-7-1-2-12(20)8-18/h3-6,9,12,20-21H,1-2,7-8H2 |
| InChIKey | BQQWHYJNEFKLDE-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |