C15H18N2O4 — CID 11197029
ethyl (2S,6S,7R)-2-methoxy-4-oxo-6-pyridin-2-yl-1-azabicyclo[4.1.0]heptane-7-carboxylate (PubChem CID 11197029) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is ethyl (2S,6S,7R)-2-methoxy-4-oxo-6-pyridin-2-yl-1-azabicyclo[4.1.0]heptane-7-carboxylate.
| Compound Name | ethyl (2S,6S,7R)-2-methoxy-4-oxo-6-pyridin-2-yl-1-azabicyclo[4.1.0]heptane-7-carboxylate |
|---|---|
| PubChem CID | 11197029 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | ethyl (2S,6S,7R)-2-methoxy-4-oxo-6-pyridin-2-yl-1-azabicyclo[4.1.0]heptane-7-carboxylate |
| SMILES | CCOC(=O)[C@@H]1N2[C@@H](OC)CC(=O)C[C@@]12c1ccccn1 |
| InChI | InChI=1S/C15H18N2O4/c1-3-21-14(19)13-15(11-6-4-5-7-16-11)9-10(18)8-12(20-2)17(13)15/h4-7,12-13H,3,8-9H2,1-2H3/t12-,13-,15+,17?/m0/s1 |
| InChIKey | FIBTVIBFKFJTAO-GIQNDGMDSA-N |
| XLogP | 0.86 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|