C17H34IN5O — CID 111970997
1-ethyl-3-[2-(3-methylbutoxy)ethyl]-2-[3-(5-methyl-1H-pyrazol-4-yl)propyl]guanidine;hydroiodide (PubChem CID 111970997) has the molecular formula C17H34IN5O and a molecular weight of 451.40 g/mol. Its IUPAC name is 1-ethyl-3-[2-(3-methylbutoxy)ethyl]-2-[3-(5-methyl-1H-pyrazol-4-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(3-methylbutoxy)ethyl]-2-[3-(5-methyl-1H-pyrazol-4-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111970997 |
| Molecular Formula | C17H34IN5O |
| Molecular Weight | 451.40 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | 1-ethyl-3-[2-(3-methylbutoxy)ethyl]-2-[3-(5-methyl-1H-pyrazol-4-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCc1cn[nH]c1C)NCCOCCC(C)C.I |
| InChI | InChI=1S/C17H33N5O.HI/c1-5-18-17(20-10-12-23-11-8-14(2)3)19-9-6-7-16-13-21-22-15(16)4;/h13-14H,5-12H2,1-4H3,(H,21,22)(H2,18,19,20);1H |
| InChIKey | ZBLXTDSPEPMRTF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|