C21H36IN3O2 — CID 111971903
2-methyl-1-[2-(3-methylbutoxy)ethyl]-3-[(4-phenyloxan-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111971903) has the molecular formula C21H36IN3O2 and a molecular weight of 489.44 g/mol. Its IUPAC name is 2-methyl-1-[2-(3-methylbutoxy)ethyl]-3-[(4-phenyloxan-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-(3-methylbutoxy)ethyl]-3-[(4-phenyloxan-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111971903 |
| Molecular Formula | C21H36IN3O2 |
| Molecular Weight | 489.44 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | 2-methyl-1-[2-(3-methylbutoxy)ethyl]-3-[(4-phenyloxan-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCOCCC(C)C)NCC1(c2ccccc2)CCOCC1.I |
| InChI | InChI=1S/C21H35N3O2.HI/c1-18(2)9-13-25-16-12-23-20(22-3)24-17-21(10-14-26-15-11-21)19-7-5-4-6-8-19;/h4-8,18H,9-17H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | TWKXWYYHBVKOBM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|