About [(3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-2-oxoindol-1-yl] acetate
[(3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-2-oxoindol-1-yl] acetate (PubChem CID 11197220) has the molecular formula C17H16N2O3
and a molecular weight of 296.33 g/mol. Its IUPAC name is [(3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-2-oxoindol-1-yl] acetate.
Molecular Properties
| Compound Name | [(3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-2-oxoindol-1-yl] acetate |
| PubChem CID | 11197220 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | [(3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-2-oxoindol-1-yl] acetate |
| SMILES | CC(=O)ON1C(=O)/C(=C\c2[nH]c(C)cc2C)c2ccccc21 |
| InChI | InChI=1S/C17H16N2O3/c1-10-8-11(2)18-15(10)9-14-13-6-4-5-7-16(13)19(17(14)21)22-12(3)20/h4-9,18H,1-3H3/b14-9- |
| InChIKey | HWWYXYHWXAFCRN-ZROIWOOFSA-N |
| XLogP | 3.00 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [(3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-2-oxoindol-1-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-2-oxoindol-1-yl] acetate?
The IUPAC name of [(3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-2-oxoindol-1-yl] acetate (CID 11197220) is [(3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-2-oxoindol-1-yl] acetate.
What is the SMILES notation for [(3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-2-oxoindol-1-yl] acetate?
The canonical SMILES for [(3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-2-oxoindol-1-yl] acetate is CC(=O)ON1C(=O)/C(=C\c2[nH]c(C)cc2C)c2ccccc21.
What is the InChIKey of [(3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-2-oxoindol-1-yl] acetate?
The InChIKey is HWWYXYHWXAFCRN-ZROIWOOFSA-N. The full InChI is InChI=1S/C17H16N2O3/c1-10-8-11(2)18-15(10)9-14-13-6-4-5-7-16(13)19(17(14)21)22-12(3)20/h4-9,18H,1-3H3/b14-9-.
What are the key properties of [(3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-2-oxoindol-1-yl] acetate?
[(3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-2-oxoindol-1-yl] acetate has a molecular weight of 296.33 g/mol, XLogP of 3.00, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-2-oxoindol-1-yl] acetate is sourced from PubChem (CID 11197220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).