About 7-ethynyl-4-oxo-1-(1,3-thiazol-2-yl)-1,8-naphthyridine-3-carboxylic acid
7-ethynyl-4-oxo-1-(1,3-thiazol-2-yl)-1,8-naphthyridine-3-carboxylic acid (PubChem CID 11197255) has the molecular formula C14H7N3O3S
and a molecular weight of 297.30 g/mol. Its IUPAC name is 7-ethynyl-4-oxo-1-(1,3-thiazol-2-yl)-1,8-naphthyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 7-ethynyl-4-oxo-1-(1,3-thiazol-2-yl)-1,8-naphthyridine-3-carboxylic acid |
| PubChem CID | 11197255 |
| Molecular Formula | C14H7N3O3S |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | 7-ethynyl-4-oxo-1-(1,3-thiazol-2-yl)-1,8-naphthyridine-3-carboxylic acid |
| SMILES | C#Cc1ccc2c(=O)c(C(=O)O)cn(-c3nccs3)c2n1 |
| InChI | InChI=1S/C14H7N3O3S/c1-2-8-3-4-9-11(18)10(13(19)20)7-17(12(9)16-8)14-15-5-6-21-14/h1,3-7H,(H,19,20) |
| InChIKey | XKCNNNZSBUJVKV-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-ethynyl-4-oxo-1-(1,3-thiazol-2-yl)-1,8-naphthyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethynyl-4-oxo-1-(1,3-thiazol-2-yl)-1,8-naphthyridine-3-carboxylic acid?
The IUPAC name of 7-ethynyl-4-oxo-1-(1,3-thiazol-2-yl)-1,8-naphthyridine-3-carboxylic acid (CID 11197255) is 7-ethynyl-4-oxo-1-(1,3-thiazol-2-yl)-1,8-naphthyridine-3-carboxylic acid.
What is the SMILES notation for 7-ethynyl-4-oxo-1-(1,3-thiazol-2-yl)-1,8-naphthyridine-3-carboxylic acid?
The canonical SMILES for 7-ethynyl-4-oxo-1-(1,3-thiazol-2-yl)-1,8-naphthyridine-3-carboxylic acid is C#Cc1ccc2c(=O)c(C(=O)O)cn(-c3nccs3)c2n1.
What is the InChIKey of 7-ethynyl-4-oxo-1-(1,3-thiazol-2-yl)-1,8-naphthyridine-3-carboxylic acid?
The InChIKey is XKCNNNZSBUJVKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H7N3O3S/c1-2-8-3-4-9-11(18)10(13(19)20)7-17(12(9)16-8)14-15-5-6-21-14/h1,3-7H,(H,19,20).
What are the key properties of 7-ethynyl-4-oxo-1-(1,3-thiazol-2-yl)-1,8-naphthyridine-3-carboxylic acid?
7-ethynyl-4-oxo-1-(1,3-thiazol-2-yl)-1,8-naphthyridine-3-carboxylic acid has a molecular weight of 297.30 g/mol, XLogP of 1.52, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethynyl-4-oxo-1-(1,3-thiazol-2-yl)-1,8-naphthyridine-3-carboxylic acid is sourced from PubChem (CID 11197255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).