About 1-(1,4-dithian-2-ylmethyl)-2,3-dimethylguanidine
1-(1,4-dithian-2-ylmethyl)-2,3-dimethylguanidine (PubChem CID 111975003) has the molecular formula C8H17N3S2
and a molecular weight of 219.38 g/mol. Its IUPAC name is 1-(1,4-dithian-2-ylmethyl)-2,3-dimethylguanidine.
Molecular Properties
| Compound Name | 1-(1,4-dithian-2-ylmethyl)-2,3-dimethylguanidine |
| PubChem CID | 111975003 |
| Molecular Formula | C8H17N3S2 |
| Molecular Weight | 219.38 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 1-(1,4-dithian-2-ylmethyl)-2,3-dimethylguanidine |
| SMILES | C/N=C(\NC)NCC1CSCCS1 |
| InChI | InChI=1S/C8H17N3S2/c1-9-8(10-2)11-5-7-6-12-3-4-13-7/h7H,3-6H2,1-2H3,(H2,9,10,11) |
| InChIKey | MFNQQTIVRHFGBE-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.38 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,4-dithian-2-ylmethyl)-2,3-dimethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,4-dithian-2-ylmethyl)-2,3-dimethylguanidine?
The IUPAC name of 1-(1,4-dithian-2-ylmethyl)-2,3-dimethylguanidine (CID 111975003) is 1-(1,4-dithian-2-ylmethyl)-2,3-dimethylguanidine.
What is the SMILES notation for 1-(1,4-dithian-2-ylmethyl)-2,3-dimethylguanidine?
The canonical SMILES for 1-(1,4-dithian-2-ylmethyl)-2,3-dimethylguanidine is C/N=C(\NC)NCC1CSCCS1.
What is the InChIKey of 1-(1,4-dithian-2-ylmethyl)-2,3-dimethylguanidine?
The InChIKey is MFNQQTIVRHFGBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N3S2/c1-9-8(10-2)11-5-7-6-12-3-4-13-7/h7H,3-6H2,1-2H3,(H2,9,10,11).
What are the key properties of 1-(1,4-dithian-2-ylmethyl)-2,3-dimethylguanidine?
1-(1,4-dithian-2-ylmethyl)-2,3-dimethylguanidine has a molecular weight of 219.38 g/mol, XLogP of 0.63, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,4-dithian-2-ylmethyl)-2,3-dimethylguanidine is sourced from PubChem (CID 111975003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).