C20H28N6 — CID 1119752
N-(3-methylphenyl)-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine (PubChem CID 1119752) has the molecular formula C20H28N6 and a molecular weight of 352.49 g/mol. Its IUPAC name is N-(3-methylphenyl)-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine.
| Compound Name | N-(3-methylphenyl)-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 1119752 |
| Molecular Formula | C20H28N6 |
| Molecular Weight | 352.49 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | N-(3-methylphenyl)-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine |
| SMILES | Cc1cccc(Nc2nc(N3CCCCC3)nc(N3CCCCC3)n2)c1 |
| InChI | InChI=1S/C20H28N6/c1-16-9-8-10-17(15-16)21-18-22-19(25-11-4-2-5-12-25)24-20(23-18)26-13-6-3-7-14-26/h8-10,15H,2-7,11-14H2,1H3,(H,21,22,23,24) |
| InChIKey | ZPHWBMFZZUNXAS-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.49 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |