About [3-[(2,4,5-trichlorophenoxy)methyl]oxetan-3-yl]methanol
[3-[(2,4,5-trichlorophenoxy)methyl]oxetan-3-yl]methanol (PubChem CID 111975884) has the molecular formula C11H11Cl3O3
and a molecular weight of 297.56 g/mol. Its IUPAC name is [3-[(2,4,5-trichlorophenoxy)methyl]oxetan-3-yl]methanol.
Molecular Properties
| Compound Name | [3-[(2,4,5-trichlorophenoxy)methyl]oxetan-3-yl]methanol |
| PubChem CID | 111975884 |
| Molecular Formula | C11H11Cl3O3 |
| Molecular Weight | 297.56 g/mol |
| Exact Mass | 295.98 |
| IUPAC Name | [3-[(2,4,5-trichlorophenoxy)methyl]oxetan-3-yl]methanol |
| SMILES | OCC1(COc2cc(Cl)c(Cl)cc2Cl)COC1 |
| InChI | InChI=1S/C11H11Cl3O3/c12-7-1-9(14)10(2-8(7)13)17-6-11(3-15)4-16-5-11/h1-2,15H,3-6H2 |
| InChIKey | ZQNQQWTUYNNIBZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.56 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze [3-[(2,4,5-trichlorophenoxy)methyl]oxetan-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(2,4,5-trichlorophenoxy)methyl]oxetan-3-yl]methanol?
The IUPAC name of [3-[(2,4,5-trichlorophenoxy)methyl]oxetan-3-yl]methanol (CID 111975884) is [3-[(2,4,5-trichlorophenoxy)methyl]oxetan-3-yl]methanol.
What is the SMILES notation for [3-[(2,4,5-trichlorophenoxy)methyl]oxetan-3-yl]methanol?
The canonical SMILES for [3-[(2,4,5-trichlorophenoxy)methyl]oxetan-3-yl]methanol is OCC1(COc2cc(Cl)c(Cl)cc2Cl)COC1.
What is the InChIKey of [3-[(2,4,5-trichlorophenoxy)methyl]oxetan-3-yl]methanol?
The InChIKey is ZQNQQWTUYNNIBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11Cl3O3/c12-7-1-9(14)10(2-8(7)13)17-6-11(3-15)4-16-5-11/h1-2,15H,3-6H2.
What are the key properties of [3-[(2,4,5-trichlorophenoxy)methyl]oxetan-3-yl]methanol?
[3-[(2,4,5-trichlorophenoxy)methyl]oxetan-3-yl]methanol has a molecular weight of 297.56 g/mol, XLogP of 3.03, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(2,4,5-trichlorophenoxy)methyl]oxetan-3-yl]methanol is sourced from PubChem (CID 111975884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).